CAS:53087-13-1 | 3-Benzyloxybromobenzene
Molecular Formula:C13H11BrO
Molecular Weight:263.13g/mol
Purity:98%
Package:5g/10g/25g/50g/bulk package
Transportation:FeDex/DHL/Ocean shipping/Clients requirement
- Verdensomspennende levering
- Kvalitetssikring
- 24/7 kundeservice
produkt introduksjon
Applications
3-Benzyloxybromobenzene(CAS:53087-13-1) has a variety of scientific research applications. It is often used as a reagent in organic synthesis, as a starting material for the synthesis of other compounds, and as a catalyst for various reactions. Additionally, it has been used in the synthesis of drugs, in the synthesis of polymers, and as a fluorescent label for proteins.
Specification
|
ITEMS |
SPECIFICATION |
|
IUPAC Name |
1-bromo-3-phenylmethoxybenzene |
|
MDL No |
MFCD00155065 |
|
Boiling Point |
333.5°C |
|
Melting Point |
57-60°C(135-140°F) |
|
Flash Point |
137.6±7.0 °C |
|
Density |
1.4±0.1 g/cm3 |
|
PSA |
9.23 |
|
LogP |
4.68 |
|
Appearance |
White to Almost white powder to crystal |
|
Vapour Pressure |
0.0±0.7 mmHg at 25°C |
|
Refractive index |
1.600 |
|
Storage condition |
Sealed in dry,Room Temperature |
|
InChI |
InChI=1S/C13H11BrO/c14-12-7-4-8-13(9-12)15-10-11-5-2-1-3-6-11/h1-9H,10H2 |
|
InChIKey |
HVWZMGZBJCJDOX-UHFFFAOYSA-N |
Populære tags: cas:53087-13-1 | 3-benzyloxybromobenzene, price, quotation, discount, in stock, for sale
