CAS:13749-61-6|N-Isopropylmethacrylamide
Molecular Formula:C7H13NO
Molecular Weight:127.18 g/mol
Purity:97%
Package:100g/250g/500g/1kg/bulk package
- Verdensomspennende levering
- Kvalitetssikring
- 24/7 kundeservice
produkt introduksjon
N-Isopropylmethacrylamide acts as a polymerization initiator, meaning it helps to initiate the polymerization process. It does this by forming a covalent bond between two molecules, which then initiates the polymerization process. This process is known as radical polymerization, and it is used to create a wide variety of polymers.
|
|
|
| 2-methyl-N-propan-2-ylprop-2-enamide | |
| MFCD00192246 | |
| 0.875 g/cm3 | |
| 241.1ºC at 760 mmHg | |
| 89-91ºC(lit.) | |
| 132.5ºC | |
| 1.431 | |
| 0.0366mmHg at 25℃ | |
| InChI=1S/C7H13NO/c1-5(2)7(9)8-6(3)4/h6H,1H2,2-4H3,(H,8,9) | |
| YQIGLEFUZMIVHU-UHFFFAOYSA-N |
Populære tags: cas:13749-61-6|n-isopropylmethacrylamide, price, quotation, discount, in stock, for sale
