![CAS:23612-48-8|2-Methyl-1H-pyrrolo[2,3-b]pyridine](/uploads/202335855/7649a990-eb5c-4c56-b601-b74233824d3c.jpg)
CAS:23612-48-8|2-Methyl-1H-pyrrolo[2,3-b]pyridine
Molecular Formula:C8H8N2
Molecular Weight:132.16 g/mol
Purity:98 percent
Package:100g/250g/500g/1kg/bulk package
- Verdensomspennende levering
- Kvalitetssikring
- 24/7 kundeservice
produkt introduksjon
2-Methyl-1H-pyrrolo[2,3-b]pyridine has a variety of applications in scientific research. It is used as a building block in the synthesis of a variety of biologically active compounds, such as antifungal agents, anticancer agents, and anti-inflammatory agents. It is also used in the synthesis of materials for electronics and optical devices. Additionally, 2-Methyl-1H-pyrrolo[2,3-b]pyridine has been used as a ligand in the synthesis of transition metal complexes.
|
|
|
| 2-methyl-1H-pyrrolo[2,3-b]pyridine | |
| MFCD08669524 | |
| 1.17 g/cm3 | |
| 282.8ºC at 760 mmHg | |
| 136-142ºC | |
| 126ºC | |
| 1.667 | |
| InChI=1S/C8H8N2/c1-6-5-7-3-2-4-9-8(7)10-6/h2-5H,1H3,(H,9,10) | |
| XDHFUUVUHNOJEW-UHFFFAOYSA-N |
Populære tags: cas:23612-48-8|2-methyl-1h-pyrrolo[2,3-b]pyridine, price, quotation, discount, in stock, for sale
