CAS:1484-10-2|9-propyl-9H-carbazole
Molecular Formula:C15H15N
Molecular Weight:209.29 g/mol
Purity:99%
Package:500g/1kg/5kg/10kg/25kg/bulk package
- Verdensomspennende levering
- Kvalitetssikring
- 24/7 kundeservice
produkt introduksjon
9-propyl-9H-carbazole(CAS:1484-10-2) has been used in a variety of scientific research applications, including drug design, organic synthesis, and materials science. In drug design, 9-propyl-9H-carbazole has been used to design novel drugs with improved efficacy and safety profiles. In organic synthesis, 9-propyl-9H-carbazole has been used as a building block to synthesize a variety of compounds, including heterocyclic compounds and polycyclic compounds. In materials science, 9-propyl-9H-carbazole has been used to create a variety of materials, such as polymers, nanomaterials, and composites.
|
|
|
| 9-propylcarbazole | |
| MFCD00218284 | |
| 361ºC at 760mmHg | |
| 172.1ºC | |
| 1.05g/cm3 | |
| White needle-like crystals | |
| 4.93 | |
| 4.20 | |
| 2.14E-05mmHg at 25℃ | |
| 1.599 | |
| InChI=1S/C15H15N/c1-2-11-16-14-9-5-3-7-12(14)13-8-4-6-10-15(13)16/h3-10H,2,11H2,1H3 | |
| QAWLNVOLYNXWPL-UHFFFAOYSA-N |

Populære tags: cas:1484-10-2|9-propyl-9h-carbazole, price, quotation, discount, in stock, for sale






![CAS:1656983-68-4|2-Brom-9-([1,1'-bifenyl]-3-yl)karbazol](/uploads/202235855/small/cas-1656983-68-4-2-bromo-9-1-1-biphenyl-3-yl48459655799.jpg?size=384x0)
![CAS:1421789-04-9|9,9'-Spirobi[fluoren]-3-ylboronsyre](/uploads/202335855/small/cas-1421789-04-9-9-9-spirobi-fluoren-3ae743c2e1-ac28-44ab-bb80-59fca7da9452.jpg?size=384x0)
